C40H44ClN7O4S — CID 91352449
2-(benzotriazol-1-yl)-N-[2-chloro-5-[[4-(2,4-dimethylphenyl)-4-hydroxybutanoyl]amino]phenyl]-4,4-dimethyl-3-oxopentanamide;N,3-dimethyl-1,3-benzothiazol-2-imine (PubChem CID 91352449) has the molecular formula C40H44ClN7O4S and a molecular weight of 754.36 g/mol. Its IUPAC name is 2-(benzotriazol-1-yl)-N-[2-chloro-5-[[4-(2,4-dimethylphenyl)-4-hydroxybutanoyl]amino]phenyl]-4,4-dimethyl-3-oxopentanamide;N,3-dimethyl-1,3-benzothiazol-2-imine.
| Compound Name | 2-(benzotriazol-1-yl)-N-[2-chloro-5-[[4-(2,4-dimethylphenyl)-4-hydroxybutanoyl]amino]phenyl]-4,4-dimethyl-3-oxopentanamide;N,3-dimethyl-1,3-benzothiazol-2-imine |
|---|---|
| PubChem CID | 91352449 |
| Molecular Formula | C40H44ClN7O4S |
| Molecular Weight | 754.36 g/mol |
| Exact Mass | 753.29 |
| IUPAC Name | 2-(benzotriazol-1-yl)-N-[2-chloro-5-[[4-(2,4-dimethylphenyl)-4-hydroxybutanoyl]amino]phenyl]-4,4-dimethyl-3-oxopentanamide;N,3-dimethyl-1,3-benzothiazol-2-imine |
| SMILES | C/N=c1\sc2ccccc2n1C.Cc1ccc(C(O)CCC(=O)Nc2ccc(Cl)c(NC(=O)C(C(=O)C(C)(C)C)n3nnc4ccccc43)c2)c(C)c1 |
| InChI | InChI=1S/C31H34ClN5O4.C9H10N2S/c1-18-10-12-21(19(2)16-18)26(38)14-15-27(39)33-20-11-13-22(32)24(17-20)34-30(41)28(29(40)31(3,4)5)37-25-9-7-6-8-23(25)35-36-37;1-10-9-11(2)7-5-3-4-6-8(7)12-9/h6-13,16-17,26,28,38H,14-15H2,1-5H3,(H,33,39)(H,34,41);3-6H,1-2H3/b;10-9- |
| InChIKey | KXPRCSVRXNDGCY-SVMKZPJVSA-N |
| XLogP | 7.72 |
| TPSA | 143.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.36 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|