C14H21N — CID 91352755
6-propyl-3,6,7,8,9,9a-hexahydrobenzo[7]annulen-5-imine (PubChem CID 91352755) has the molecular formula C14H21N and a molecular weight of 203.33 g/mol. Its IUPAC name is 6-propyl-3,6,7,8,9,9a-hexahydrobenzo[7]annulen-5-imine.
| Compound Name | 6-propyl-3,6,7,8,9,9a-hexahydrobenzo[7]annulen-5-imine |
|---|---|
| PubChem CID | 91352755 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | 6-propyl-3,6,7,8,9,9a-hexahydrobenzo[7]annulen-5-imine |
| SMILES | [H]/N=C1/C2=CCC=CC2CCCC1CCC |
| InChI | InChI=1S/C14H21N/c1-2-6-12-9-5-8-11-7-3-4-10-13(11)14(12)15/h3,7,10-12,15H,2,4-6,8-9H2,1H3/b15-14+ |
| InChIKey | GANSUYMDJYHXRR-CCEZHUSRSA-N |
| XLogP | 4.11 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|