C17H17N2O3P — CID 91355166
ethoxy-[3-(2-phenylethenyl)-2H-indazol-5-yl]phosphinic acid (PubChem CID 91355166) has the molecular formula C17H17N2O3P and a molecular weight of 328.31 g/mol. Its IUPAC name is ethoxy-[3-(2-phenylethenyl)-2H-indazol-5-yl]phosphinic acid.
| Compound Name | ethoxy-[3-(2-phenylethenyl)-2H-indazol-5-yl]phosphinic acid |
|---|---|
| PubChem CID | 91355166 |
| Molecular Formula | C17H17N2O3P |
| Molecular Weight | 328.31 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | ethoxy-[3-(2-phenylethenyl)-2H-indazol-5-yl]phosphinic acid |
| SMILES | CCOP(=O)(O)c1ccc2n[nH]c(C=Cc3ccccc3)c2c1 |
| InChI | InChI=1S/C17H17N2O3P/c1-2-22-23(20,21)14-9-11-17-15(12-14)16(18-19-17)10-8-13-6-4-3-5-7-13/h3-12H,2H2,1H3,(H,18,19)(H,20,21) |
| InChIKey | WMKCTCAVKKFBRY-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 75.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.31 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|