C13H14ClN3O3S — CID 91358336
4-chloro-3-[(4-hydroxy-1,3-thiazol-2-yl)amino]-N-(2-methoxyethyl)benzamide (PubChem CID 91358336) has the molecular formula C13H14ClN3O3S and a molecular weight of 327.79 g/mol. Its IUPAC name is 4-chloro-3-[(4-hydroxy-1,3-thiazol-2-yl)amino]-N-(2-methoxyethyl)benzamide.
| Compound Name | 4-chloro-3-[(4-hydroxy-1,3-thiazol-2-yl)amino]-N-(2-methoxyethyl)benzamide |
|---|---|
| PubChem CID | 91358336 |
| Molecular Formula | C13H14ClN3O3S |
| Molecular Weight | 327.79 g/mol |
| Exact Mass | 327.04 |
| IUPAC Name | 4-chloro-3-[(4-hydroxy-1,3-thiazol-2-yl)amino]-N-(2-methoxyethyl)benzamide |
| SMILES | COCCNC(=O)c1ccc(Cl)c(Nc2nc(O)cs2)c1 |
| InChI | InChI=1S/C13H14ClN3O3S/c1-20-5-4-15-12(19)8-2-3-9(14)10(6-8)16-13-17-11(18)7-21-13/h2-3,6-7,18H,4-5H2,1H3,(H,15,19)(H,16,17) |
| InChIKey | WGZIRRWHPSXXEI-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.79 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|