C19H18F3N3O2S — CID 91359113
2-[4-[4-(trifluoromethoxy)anilino]piperidin-1-yl]-1,3-benzothiazol-6-ol (PubChem CID 91359113) has the molecular formula C19H18F3N3O2S and a molecular weight of 409.43 g/mol. Its IUPAC name is 2-[4-[4-(trifluoromethoxy)anilino]piperidin-1-yl]-1,3-benzothiazol-6-ol.
| Compound Name | 2-[4-[4-(trifluoromethoxy)anilino]piperidin-1-yl]-1,3-benzothiazol-6-ol |
|---|---|
| PubChem CID | 91359113 |
| Molecular Formula | C19H18F3N3O2S |
| Molecular Weight | 409.43 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | 2-[4-[4-(trifluoromethoxy)anilino]piperidin-1-yl]-1,3-benzothiazol-6-ol |
| SMILES | Oc1ccc2nc(N3CCC(Nc4ccc(OC(F)(F)F)cc4)CC3)sc2c1 |
| InChI | InChI=1S/C19H18F3N3O2S/c20-19(21,22)27-15-4-1-12(2-5-15)23-13-7-9-25(10-8-13)18-24-16-6-3-14(26)11-17(16)28-18/h1-6,11,13,23,26H,7-10H2 |
| InChIKey | CKEIMTYQBREYST-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 57.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.43 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|