C18H19N3OS — CID 91441677
2-(4-anilinopiperidin-1-yl)-1,3-benzothiazol-6-ol (PubChem CID 91441677) has the molecular formula C18H19N3OS and a molecular weight of 325.44 g/mol. Its IUPAC name is 2-(4-anilinopiperidin-1-yl)-1,3-benzothiazol-6-ol.
| Compound Name | 2-(4-anilinopiperidin-1-yl)-1,3-benzothiazol-6-ol |
|---|---|
| PubChem CID | 91441677 |
| Molecular Formula | C18H19N3OS |
| Molecular Weight | 325.44 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | 2-(4-anilinopiperidin-1-yl)-1,3-benzothiazol-6-ol |
| SMILES | Oc1ccc2nc(N3CCC(Nc4ccccc4)CC3)sc2c1 |
| InChI | InChI=1S/C18H19N3OS/c22-15-6-7-16-17(12-15)23-18(20-16)21-10-8-14(9-11-21)19-13-4-2-1-3-5-13/h1-7,12,14,19,22H,8-11H2 |
| InChIKey | VLPREFTZNODDGD-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.44 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |