C10H11N3O — CID 91360819
3a,4,5,9b-tetrahydro-3H-imidazo[4,5-c]quinolin-9-ol (PubChem CID 91360819) has the molecular formula C10H11N3O and a molecular weight of 189.22 g/mol. Its IUPAC name is 3a,4,5,9b-tetrahydro-3H-imidazo[4,5-c]quinolin-9-ol.
| Compound Name | 3a,4,5,9b-tetrahydro-3H-imidazo[4,5-c]quinolin-9-ol |
|---|---|
| PubChem CID | 91360819 |
| Molecular Formula | C10H11N3O |
| Molecular Weight | 189.22 g/mol |
| Exact Mass | 189.09 |
| IUPAC Name | 3a,4,5,9b-tetrahydro-3H-imidazo[4,5-c]quinolin-9-ol |
| SMILES | Oc1cccc2c1C1N=CNC1CN2 |
| InChI | InChI=1S/C10H11N3O/c14-8-3-1-2-6-9(8)10-7(4-11-6)12-5-13-10/h1-3,5,7,10-11,14H,4H2,(H,12,13) |
| InChIKey | LWWCTAXAWRWMIW-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.22 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|