C17H12FNO5 — CID 91364556
carbamoyl 2-(2-fluorophenyl)-5-methoxy-1-benzofuran-3-carboxylate (PubChem CID 91364556) has the molecular formula C17H12FNO5 and a molecular weight of 329.28 g/mol. Its IUPAC name is carbamoyl 2-(2-fluorophenyl)-5-methoxy-1-benzofuran-3-carboxylate.
| Compound Name | carbamoyl 2-(2-fluorophenyl)-5-methoxy-1-benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 91364556 |
| Molecular Formula | C17H12FNO5 |
| Molecular Weight | 329.28 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | carbamoyl 2-(2-fluorophenyl)-5-methoxy-1-benzofuran-3-carboxylate |
| SMILES | COc1ccc2oc(-c3ccccc3F)c(C(=O)OC(N)=O)c2c1 |
| InChI | InChI=1S/C17H12FNO5/c1-22-9-6-7-13-11(8-9)14(16(20)24-17(19)21)15(23-13)10-4-2-3-5-12(10)18/h2-8H,1H3,(H2,19,21) |
| InChIKey | JFXGKHGXEAHGSV-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.28 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|