C9H16N4O2 — CID 91364773
(3S,4S)-4-azido-1-(oxan-4-yl)pyrrolidin-3-ol (PubChem CID 91364773) has the molecular formula C9H16N4O2 and a molecular weight of 212.25 g/mol. Its IUPAC name is (3S,4S)-4-azido-1-(oxan-4-yl)pyrrolidin-3-ol.
| Compound Name | (3S,4S)-4-azido-1-(oxan-4-yl)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 91364773 |
| Molecular Formula | C9H16N4O2 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | (3S,4S)-4-azido-1-(oxan-4-yl)pyrrolidin-3-ol |
| SMILES | [N-]=[N+]=N[C@H]1CN(C2CCOCC2)C[C@@H]1O |
| InChI | InChI=1S/C9H16N4O2/c10-12-11-8-5-13(6-9(8)14)7-1-3-15-4-2-7/h7-9,14H,1-6H2/t8-,9-/m0/s1 |
| InChIKey | AGTFLJGUEKECBI-IUCAKERBSA-N |
| XLogP | 0.52 |
| TPSA | 81.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|