C13H20F2O — CID 91365851
3-(2,2-difluoroethoxy)-9-methyldeca-3,5,6-triene (PubChem CID 91365851) has the molecular formula C13H20F2O and a molecular weight of 230.30 g/mol. Its IUPAC name is 3-(2,2-difluoroethoxy)-9-methyldeca-3,5,6-triene.
| Compound Name | 3-(2,2-difluoroethoxy)-9-methyldeca-3,5,6-triene |
|---|---|
| PubChem CID | 91365851 |
| Molecular Formula | C13H20F2O |
| Molecular Weight | 230.30 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | 3-(2,2-difluoroethoxy)-9-methyldeca-3,5,6-triene |
| SMILES | CCC(=CC=C=CCC(C)C)OCC(F)F |
| InChI | InChI=1S/C13H20F2O/c1-4-12(16-10-13(14)15)9-7-5-6-8-11(2)3/h6-7,9,11,13H,4,8,10H2,1-3H3 |
| InChIKey | LDGMLWCBJKHXMX-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.30 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|