C19H24FNO4 — CID 91368038
tert-butyl (2S,5R)-2-(3-fluorophenyl)-5-(3-methoxy-3-oxoprop-1-enyl)pyrrolidine-1-carboxylate (PubChem CID 91368038) has the molecular formula C19H24FNO4 and a molecular weight of 349.40 g/mol. Its IUPAC name is tert-butyl (2S,5R)-2-(3-fluorophenyl)-5-(3-methoxy-3-oxoprop-1-enyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,5R)-2-(3-fluorophenyl)-5-(3-methoxy-3-oxoprop-1-enyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 91368038 |
| Molecular Formula | C19H24FNO4 |
| Molecular Weight | 349.40 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | tert-butyl (2S,5R)-2-(3-fluorophenyl)-5-(3-methoxy-3-oxoprop-1-enyl)pyrrolidine-1-carboxylate |
| SMILES | COC(=O)C=C[C@H]1CC[C@@H](c2cccc(F)c2)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H24FNO4/c1-19(2,3)25-18(23)21-15(9-11-17(22)24-4)8-10-16(21)13-6-5-7-14(20)12-13/h5-7,9,11-12,15-16H,8,10H2,1-4H3/t15-,16+/m1/s1 |
| InChIKey | LGRDASRLURVOEE-CVEARBPZSA-N |
| XLogP | 4.00 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.40 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|