C26H36N2O2 — CID 91368577
N-[3-[1-[(1S)-1-hydroxy-5-phenylpentyl]piperidin-4-yl]phenyl]-2-methylpropanamide (PubChem CID 91368577) has the molecular formula C26H36N2O2 and a molecular weight of 408.59 g/mol. Its IUPAC name is N-[3-[1-[(1S)-1-hydroxy-5-phenylpentyl]piperidin-4-yl]phenyl]-2-methylpropanamide.
| Compound Name | N-[3-[1-[(1S)-1-hydroxy-5-phenylpentyl]piperidin-4-yl]phenyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 91368577 |
| Molecular Formula | C26H36N2O2 |
| Molecular Weight | 408.59 g/mol |
| Exact Mass | 408.28 |
| IUPAC Name | N-[3-[1-[(1S)-1-hydroxy-5-phenylpentyl]piperidin-4-yl]phenyl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)Nc1cccc(C2CCN([C@@H](O)CCCCc3ccccc3)CC2)c1 |
| InChI | InChI=1S/C26H36N2O2/c1-20(2)26(30)27-24-13-8-12-23(19-24)22-15-17-28(18-16-22)25(29)14-7-6-11-21-9-4-3-5-10-21/h3-5,8-10,12-13,19-20,22,25,29H,6-7,11,14-18H2,1-2H3,(H,27,30)/t25-/m0/s1 |
| InChIKey | PWDKLIXEYMLQNA-VWLOTQADSA-N |
| XLogP | 5.19 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.59 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|