C30H33FN6O2 — CID 91369998
2-[cyano-[N'-[4-(4-fluorophenoxy)phenyl]carbamimidoyl]amino]-3-phenyl-N-(3-pyrrolidin-1-ylpropyl)propanamide (PubChem CID 91369998) has the molecular formula C30H33FN6O2 and a molecular weight of 528.63 g/mol. Its IUPAC name is 2-[cyano-[N'-[4-(4-fluorophenoxy)phenyl]carbamimidoyl]amino]-3-phenyl-N-(3-pyrrolidin-1-ylpropyl)propanamide.
| Compound Name | 2-[cyano-[N'-[4-(4-fluorophenoxy)phenyl]carbamimidoyl]amino]-3-phenyl-N-(3-pyrrolidin-1-ylpropyl)propanamide |
|---|---|
| PubChem CID | 91369998 |
| Molecular Formula | C30H33FN6O2 |
| Molecular Weight | 528.63 g/mol |
| Exact Mass | 528.26 |
| IUPAC Name | 2-[cyano-[N'-[4-(4-fluorophenoxy)phenyl]carbamimidoyl]amino]-3-phenyl-N-(3-pyrrolidin-1-ylpropyl)propanamide |
| SMILES | N#CN(/C(N)=N/c1ccc(Oc2ccc(F)cc2)cc1)C(Cc1ccccc1)C(=O)NCCCN1CCCC1 |
| InChI | InChI=1S/C30H33FN6O2/c31-24-9-13-26(14-10-24)39-27-15-11-25(12-16-27)35-30(33)37(22-32)28(21-23-7-2-1-3-8-23)29(38)34-17-6-20-36-18-4-5-19-36/h1-3,7-16,28H,4-6,17-21H2,(H2,33,35)(H,34,38) |
| InChIKey | CDWYXMAXRUTLBF-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 106.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.63 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|