C18H20N2O3S — CID 91373091
(3S,4S)-4-(2-methylphenyl)-1-pyridin-3-ylsulfonylpiperidine-3-carbaldehyde (PubChem CID 91373091) has the molecular formula C18H20N2O3S and a molecular weight of 344.44 g/mol. Its IUPAC name is (3S,4S)-4-(2-methylphenyl)-1-pyridin-3-ylsulfonylpiperidine-3-carbaldehyde.
| Compound Name | (3S,4S)-4-(2-methylphenyl)-1-pyridin-3-ylsulfonylpiperidine-3-carbaldehyde |
|---|---|
| PubChem CID | 91373091 |
| Molecular Formula | C18H20N2O3S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | (3S,4S)-4-(2-methylphenyl)-1-pyridin-3-ylsulfonylpiperidine-3-carbaldehyde |
| SMILES | Cc1ccccc1[C@H]1CCN(S(=O)(=O)c2cccnc2)C[C@H]1C=O |
| InChI | InChI=1S/C18H20N2O3S/c1-14-5-2-3-7-17(14)18-8-10-20(12-15(18)13-21)24(22,23)16-6-4-9-19-11-16/h2-7,9,11,13,15,18H,8,10,12H2,1H3/t15-,18-/m0/s1 |
| InChIKey | FFVASEQWGOSTPA-YJBOKZPZSA-N |
| XLogP | 2.38 |
| TPSA | 67.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|