C22H10F25NO — CID 91373559
5-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-pentacosafluorotridecyl)-3-phenyl-2,5-dihydro-1,2-oxazole (PubChem CID 91373559) has the molecular formula C22H10F25NO and a molecular weight of 779.28 g/mol. Its IUPAC name is 5-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-pentacosafluorotridecyl)-3-phenyl-2,5-dihydro-1,2-oxazole.
| Compound Name | 5-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-pentacosafluorotridecyl)-3-phenyl-2,5-dihydro-1,2-oxazole |
|---|---|
| PubChem CID | 91373559 |
| Molecular Formula | C22H10F25NO |
| Molecular Weight | 779.28 g/mol |
| Exact Mass | 779.04 |
| IUPAC Name | 5-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-pentacosafluorotridecyl)-3-phenyl-2,5-dihydro-1,2-oxazole |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CC1C=C(c2ccccc2)NO1 |
| InChI | InChI=1S/C22H10F25NO/c23-11(24,7-9-6-10(48-49-9)8-4-2-1-3-5-8)12(25,26)13(27,28)14(29,30)15(31,32)16(33,34)17(35,36)18(37,38)19(39,40)20(41,42)21(43,44)22(45,46)47/h1-6,9,48H,7H2 |
| InChIKey | CTEYVELDLMAVDU-UHFFFAOYSA-N |
| XLogP | 9.87 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.28 |
| LogP ≤ 5 | 9.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|