C25H31FO6S — CID 91374475
[(1S,13R,17S)-8-fluoro-14-(hydroxymethylsulfanylcarbonyl)-2,13,15-trimethyl-5-oxo-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadeca-3,7-dien-14-yl] propanoate (PubChem CID 91374475) has the molecular formula C25H31FO6S and a molecular weight of 478.58 g/mol. Its IUPAC name is [(1S,13R,17S)-8-fluoro-14-(hydroxymethylsulfanylcarbonyl)-2,13,15-trimethyl-5-oxo-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadeca-3,7-dien-14-yl] propanoate.
| Compound Name | [(1S,13R,17S)-8-fluoro-14-(hydroxymethylsulfanylcarbonyl)-2,13,15-trimethyl-5-oxo-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadeca-3,7-dien-14-yl] propanoate |
|---|---|
| PubChem CID | 91374475 |
| Molecular Formula | C25H31FO6S |
| Molecular Weight | 478.58 g/mol |
| Exact Mass | 478.18 |
| IUPAC Name | [(1S,13R,17S)-8-fluoro-14-(hydroxymethylsulfanylcarbonyl)-2,13,15-trimethyl-5-oxo-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadeca-3,7-dien-14-yl] propanoate |
| SMILES | CCC(=O)OC1(C(=O)SCO)[C@H](C)CC2C3CC(F)=C4CC(=O)C=CC4(C)[C@@]34O[C@H]4CC21C |
| InChI | InChI=1S/C25H31FO6S/c1-5-20(29)32-24(21(30)33-12-27)13(2)8-15-16-10-18(26)17-9-14(28)6-7-22(17,3)25(16)19(31-25)11-23(15,24)4/h6-7,13,15-16,19,27H,5,8-12H2,1-4H3/t13-,15?,16?,19+,22?,23?,24?,25-/m1/s1 |
| InChIKey | GSRKJPKKQXYPKX-RBSABEPKSA-N |
| XLogP | 3.87 |
| TPSA | 93.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.58 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|