C27H27F3O6S — CID 91190687
[(9R,10S,13S,16R,17R)-6,9-difluoro-17-(fluoromethylsulfanylcarbonyl)-10,13,16-trimethyl-3,11-dioxo-7,8,12,14,15,16-hexahydro-4H-cyclopenta[a]phenanthren-17-yl] furan-2-carboxylate (PubChem CID 91190687) has the molecular formula C27H27F3O6S and a molecular weight of 536.57 g/mol. Its IUPAC name is [(9R,10S,13S,16R,17R)-6,9-difluoro-17-(fluoromethylsulfanylcarbonyl)-10,13,16-trimethyl-3,11-dioxo-7,8,12,14,15,16-hexahydro-4H-cyclopenta[a]phenanthren-17-yl] furan-2-carboxylate.
| Compound Name | [(9R,10S,13S,16R,17R)-6,9-difluoro-17-(fluoromethylsulfanylcarbonyl)-10,13,16-trimethyl-3,11-dioxo-7,8,12,14,15,16-hexahydro-4H-cyclopenta[a]phenanthren-17-yl] furan-2-carboxylate |
|---|---|
| PubChem CID | 91190687 |
| Molecular Formula | C27H27F3O6S |
| Molecular Weight | 536.57 g/mol |
| Exact Mass | 536.15 |
| IUPAC Name | [(9R,10S,13S,16R,17R)-6,9-difluoro-17-(fluoromethylsulfanylcarbonyl)-10,13,16-trimethyl-3,11-dioxo-7,8,12,14,15,16-hexahydro-4H-cyclopenta[a]phenanthren-17-yl] furan-2-carboxylate |
| SMILES | C[C@@H]1CC2C3CC(F)=C4CC(=O)C=C[C@]4(C)[C@@]3(F)C(=O)C[C@]2(C)[C@@]1(OC(=O)c1ccco1)C(=O)SCF |
| InChI | InChI=1S/C27H27F3O6S/c1-14-9-16-17-11-19(29)18-10-15(31)6-7-24(18,2)26(17,30)21(32)12-25(16,3)27(14,23(34)37-13-28)36-22(33)20-5-4-8-35-20/h4-8,14,16-17H,9-13H2,1-3H3/t14-,16?,17?,24+,25+,26+,27+/m1/s1 |
| InChIKey | BCUKQGBZDKYGJH-LJVBWHRNSA-N |
| XLogP | 5.48 |
| TPSA | 90.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.57 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|