C27H29FO5S — CID 91075477
(1S,2S,13R,14S,15S,17S)-8-fluoro-14-[2-(furan-2-yl)-2-oxoethyl]-2,13,15-trimethyl-5-oxo-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadeca-3,7-diene-14-carbothioic S-acid (PubChem CID 91075477) has the molecular formula C27H29FO5S and a molecular weight of 484.59 g/mol. Its IUPAC name is (1S,2S,13R,14S,15S,17S)-8-fluoro-14-[2-(furan-2-yl)-2-oxoethyl]-2,13,15-trimethyl-5-oxo-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadeca-3,7-diene-14-carbothioic S-acid.
| Compound Name | (1S,2S,13R,14S,15S,17S)-8-fluoro-14-[2-(furan-2-yl)-2-oxoethyl]-2,13,15-trimethyl-5-oxo-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadeca-3,7-diene-14-carbothioic S-acid |
|---|---|
| PubChem CID | 91075477 |
| Molecular Formula | C27H29FO5S |
| Molecular Weight | 484.59 g/mol |
| Exact Mass | 484.17 |
| IUPAC Name | (1S,2S,13R,14S,15S,17S)-8-fluoro-14-[2-(furan-2-yl)-2-oxoethyl]-2,13,15-trimethyl-5-oxo-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadeca-3,7-diene-14-carbothioic S-acid |
| SMILES | C[C@@H]1CC2C3CC(F)=C4CC(=O)C=C[C@]4(C)[C@@]34O[C@H]4C[C@]2(C)[C@@]1(CC(=O)c1ccco1)C(=O)S |
| InChI | InChI=1S/C27H29FO5S/c1-14-9-16-17-11-19(28)18-10-15(29)6-7-24(18,2)27(17)22(33-27)13-25(16,3)26(14,23(31)34)12-20(30)21-5-4-8-32-21/h4-8,14,16-17,22H,9-13H2,1-3H3,(H,31,34)/t14-,16?,17?,22+,24+,25+,26-,27-/m1/s1 |
| InChIKey | KQGLURDABAONGI-JAHSFDNUSA-N |
| XLogP | 5.28 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.59 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|