C28H30F2O4S — CID 90920515
S-(fluoromethyl) (10R,13S,16R,17S)-6-fluoro-17-[2-(furan-2-yl)-2-oxoethyl]-10,13,16-trimethyl-3-oxo-7,8,12,14,15,16-hexahydro-4H-cyclopenta[a]phenanthrene-17-carbothioate (PubChem CID 90920515) has the molecular formula C28H30F2O4S and a molecular weight of 500.61 g/mol. Its IUPAC name is S-(fluoromethyl) (10R,13S,16R,17S)-6-fluoro-17-[2-(furan-2-yl)-2-oxoethyl]-10,13,16-trimethyl-3-oxo-7,8,12,14,15,16-hexahydro-4H-cyclopenta[a]phenanthrene-17-carbothioate.
| Compound Name | S-(fluoromethyl) (10R,13S,16R,17S)-6-fluoro-17-[2-(furan-2-yl)-2-oxoethyl]-10,13,16-trimethyl-3-oxo-7,8,12,14,15,16-hexahydro-4H-cyclopenta[a]phenanthrene-17-carbothioate |
|---|---|
| PubChem CID | 90920515 |
| Molecular Formula | C28H30F2O4S |
| Molecular Weight | 500.61 g/mol |
| Exact Mass | 500.18 |
| IUPAC Name | S-(fluoromethyl) (10R,13S,16R,17S)-6-fluoro-17-[2-(furan-2-yl)-2-oxoethyl]-10,13,16-trimethyl-3-oxo-7,8,12,14,15,16-hexahydro-4H-cyclopenta[a]phenanthrene-17-carbothioate |
| SMILES | C[C@@H]1CC2C3CC(F)=C4CC(=O)C=C[C@]4(C)C3=CC[C@]2(C)[C@@]1(CC(=O)c1ccco1)C(=O)SCF |
| InChI | InChI=1S/C28H30F2O4S/c1-16-11-20-18-13-22(30)21-12-17(31)6-8-26(21,2)19(18)7-9-27(20,3)28(16,25(33)35-15-29)14-23(32)24-5-4-10-34-24/h4-8,10,16,18,20H,9,11-15H2,1-3H3/t16-,18?,20?,26-,27+,28-/m1/s1 |
| InChIKey | RQMSWYPTDNNSJJ-YECKRIQSSA-N |
| XLogP | 6.80 |
| TPSA | 64.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.61 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|