C11H13ClO — CID 91375491
2-(4-ethylcyclohepta-1,4,6-trien-1-yl)acetyl chloride (PubChem CID 91375491) has the molecular formula C11H13ClO and a molecular weight of 196.68 g/mol. Its IUPAC name is 2-(4-ethylcyclohepta-1,4,6-trien-1-yl)acetyl chloride.
| Compound Name | 2-(4-ethylcyclohepta-1,4,6-trien-1-yl)acetyl chloride |
|---|---|
| PubChem CID | 91375491 |
| Molecular Formula | C11H13ClO |
| Molecular Weight | 196.68 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | 2-(4-ethylcyclohepta-1,4,6-trien-1-yl)acetyl chloride |
| SMILES | CCC1=CC=CC(CC(=O)Cl)=CC1 |
| InChI | InChI=1S/C11H13ClO/c1-2-9-4-3-5-10(7-6-9)8-11(12)13/h3-5,7H,2,6,8H2,1H3 |
| InChIKey | MNGISFWADRBOQY-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.68 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|