2-(4-ethylcyclohepta-1,4,6-trien-1-yl)acetyl chloride

C11H13ClO — CID 91375491

IUPAC2-(4-ethylcyclohepta-1,4,6-trien-1-yl)acetyl chloride
SMILESCCC1=CC=CC(CC(=O)Cl)=CC1
InChIInChI=1S/C11H13ClO/c1-2-9-4-3-5-10(7-6-9)8-11(12)13/h3-5,7H,2,6,8H2,1H3
InChIKeyMNGISFWADRBOQY-UHFFFAOYSA-N
MW196.68 g/mol
LogP3.36
Rot. Bonds3

About 2-(4-ethylcyclohepta-1,4,6-trien-1-yl)acetyl chloride

2-(4-ethylcyclohepta-1,4,6-trien-1-yl)acetyl chloride (PubChem CID 91375491) has the molecular formula C11H13ClO and a molecular weight of 196.68 g/mol. Its IUPAC name is 2-(4-ethylcyclohepta-1,4,6-trien-1-yl)acetyl chloride.

Molecular Properties

Compound Name2-(4-ethylcyclohepta-1,4,6-trien-1-yl)acetyl chloride
PubChem CID91375491
Molecular FormulaC11H13ClO
Molecular Weight196.68 g/mol
Exact Mass196.07
IUPAC Name2-(4-ethylcyclohepta-1,4,6-trien-1-yl)acetyl chloride
SMILESCCC1=CC=CC(CC(=O)Cl)=CC1
InChIInChI=1S/C11H13ClO/c1-2-9-4-3-5-10(7-6-9)8-11(12)13/h3-5,7H,2,6,8H2,1H3
InChIKeyMNGISFWADRBOQY-UHFFFAOYSA-N
XLogP3.36
TPSA17.07 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds3
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500196.68
LogP ≤ 53.36
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 2-(4-ethylcyclohepta-1,4,6-trien-1-yl)acetyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(4-ethylcyclohepta-1,4,6-trien-1-yl)acetyl chloride?
The IUPAC name of 2-(4-ethylcyclohepta-1,4,6-trien-1-yl)acetyl chloride (CID 91375491) is 2-(4-ethylcyclohepta-1,4,6-trien-1-yl)acetyl chloride.
What is the SMILES notation for 2-(4-ethylcyclohepta-1,4,6-trien-1-yl)acetyl chloride?
The canonical SMILES for 2-(4-ethylcyclohepta-1,4,6-trien-1-yl)acetyl chloride is CCC1=CC=CC(CC(=O)Cl)=CC1.
What is the InChIKey of 2-(4-ethylcyclohepta-1,4,6-trien-1-yl)acetyl chloride?
The InChIKey is MNGISFWADRBOQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13ClO/c1-2-9-4-3-5-10(7-6-9)8-11(12)13/h3-5,7H,2,6,8H2,1H3.
What are the key properties of 2-(4-ethylcyclohepta-1,4,6-trien-1-yl)acetyl chloride?
2-(4-ethylcyclohepta-1,4,6-trien-1-yl)acetyl chloride has a molecular weight of 196.68 g/mol, XLogP of 3.36, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-ethylcyclohepta-1,4,6-trien-1-yl)acetyl chloride is sourced from PubChem (CID 91375491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).