C32H36N2O4 — CID 91377428
N-[(4R,4aS,5R,7aS,12bS)-3-(cyclopropylmethyl)-4a,9-dihydroxy-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-5-yl]-3-(3,4-dimethylphenyl)-N-methylprop-2-ynamide (PubChem CID 91377428) has the molecular formula C32H36N2O4 and a molecular weight of 512.65 g/mol. Its IUPAC name is N-[(4R,4aS,5R,7aS,12bS)-3-(cyclopropylmethyl)-4a,9-dihydroxy-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-5-yl]-3-(3,4-dimethylphenyl)-N-methylprop-2-ynamide.
| Compound Name | N-[(4R,4aS,5R,7aS,12bS)-3-(cyclopropylmethyl)-4a,9-dihydroxy-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-5-yl]-3-(3,4-dimethylphenyl)-N-methylprop-2-ynamide |
|---|---|
| PubChem CID | 91377428 |
| Molecular Formula | C32H36N2O4 |
| Molecular Weight | 512.65 g/mol |
| Exact Mass | 512.27 |
| IUPAC Name | N-[(4R,4aS,5R,7aS,12bS)-3-(cyclopropylmethyl)-4a,9-dihydroxy-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-5-yl]-3-(3,4-dimethylphenyl)-N-methylprop-2-ynamide |
| SMILES | Cc1ccc(C#CC(=O)N(C)[C@@H]2CC[C@@H]3Oc4c(O)ccc5c4[C@@]34CCN(CC3CC3)[C@H](C5)[C@]24O)cc1C |
| InChI | InChI=1S/C32H36N2O4/c1-19-4-5-21(16-20(19)2)8-13-28(36)33(3)25-11-12-27-31-14-15-34(18-22-6-7-22)26(32(25,31)37)17-23-9-10-24(35)30(38-27)29(23)31/h4-5,9-10,16,22,25-27,35,37H,6-7,11-12,14-15,17-18H2,1-3H3/t25-,26-,27+,31-,32-/m1/s1 |
| InChIKey | NFUQLYNJJKTNHM-CWXJPABJSA-N |
| XLogP | 3.45 |
| TPSA | 73.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.65 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|