C34H49N3O6 — CID 91377694
4-[4-[3-(3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl)propanoylamino]-2-methylbutan-2-yl]oxy-2,2-dimethyl-N-[4-(4-methylphenoxy)butyl]butanamide (PubChem CID 91377694) has the molecular formula C34H49N3O6 and a molecular weight of 595.78 g/mol. Its IUPAC name is 4-[4-[3-(3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl)propanoylamino]-2-methylbutan-2-yl]oxy-2,2-dimethyl-N-[4-(4-methylphenoxy)butyl]butanamide.
| Compound Name | 4-[4-[3-(3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl)propanoylamino]-2-methylbutan-2-yl]oxy-2,2-dimethyl-N-[4-(4-methylphenoxy)butyl]butanamide |
|---|---|
| PubChem CID | 91377694 |
| Molecular Formula | C34H49N3O6 |
| Molecular Weight | 595.78 g/mol |
| Exact Mass | 595.36 |
| IUPAC Name | 4-[4-[3-(3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl)propanoylamino]-2-methylbutan-2-yl]oxy-2,2-dimethyl-N-[4-(4-methylphenoxy)butyl]butanamide |
| SMILES | Cc1ccc(OCCCCNC(=O)C(C)(C)CCOC(C)(C)CCNC(=O)CCn2c(O)c3c(c2O)C2C=CC3C2)cc1 |
| InChI | InChI=1S/C34H49N3O6/c1-23-8-12-26(13-9-23)42-20-7-6-17-36-32(41)33(2,3)16-21-43-34(4,5)15-18-35-27(38)14-19-37-30(39)28-24-10-11-25(22-24)29(28)31(37)40/h8-13,24-25,39-40H,6-7,14-22H2,1-5H3,(H,35,38)(H,36,41) |
| InChIKey | SZUHBPAIQJUMGC-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 122.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.78 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|