C36H50N4O7 — CID 123953321
N-[4-(4-aminophenoxy)butyl]-4-[1-[3-(1,3-dioxo-4,7-epoxyisoindol-2-yl)propanoylamino]-3,4,5-trimethylhexan-3-yl]oxy-2,2-dimethylbutanamide (PubChem CID 123953321) has the molecular formula C36H50N4O7 and a molecular weight of 650.82 g/mol. Its IUPAC name is N-[4-(4-aminophenoxy)butyl]-4-[1-[3-(1,3-dioxo-4,7-epoxyisoindol-2-yl)propanoylamino]-3,4,5-trimethylhexan-3-yl]oxy-2,2-dimethylbutanamide.
| Compound Name | N-[4-(4-aminophenoxy)butyl]-4-[1-[3-(1,3-dioxo-4,7-epoxyisoindol-2-yl)propanoylamino]-3,4,5-trimethylhexan-3-yl]oxy-2,2-dimethylbutanamide |
|---|---|
| PubChem CID | 123953321 |
| Molecular Formula | C36H50N4O7 |
| Molecular Weight | 650.82 g/mol |
| Exact Mass | 650.37 |
| IUPAC Name | N-[4-(4-aminophenoxy)butyl]-4-[1-[3-(1,3-dioxo-4,7-epoxyisoindol-2-yl)propanoylamino]-3,4,5-trimethylhexan-3-yl]oxy-2,2-dimethylbutanamide |
| SMILES | CC(C)C(C)C(C)(CCNC(=O)CCN1C(=O)c2c(c3ccc2o3)C1=O)OCCC(C)(C)C(=O)NCCCCOc1ccc(N)cc1 |
| InChI | InChI=1S/C36H50N4O7/c1-23(2)24(3)36(6,16-19-38-29(41)15-20-40-32(42)30-27-13-14-28(47-27)31(30)33(40)43)46-22-17-35(4,5)34(44)39-18-7-8-21-45-26-11-9-25(37)10-12-26/h9-14,23-24H,7-8,15-22,37H2,1-6H3,(H,38,41)(H,39,44) |
| InChIKey | FVVKRSMRXIOFQK-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 153.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.82 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|