C19H18ClF3N2O2 — CID 91378525
N-(1-chloro-1,2,3,4-tetrahydroisoquinolin-7-yl)-4-ethoxy-3-(trifluoromethyl)benzamide (PubChem CID 91378525) has the molecular formula C19H18ClF3N2O2 and a molecular weight of 398.81 g/mol. Its IUPAC name is N-(1-chloro-1,2,3,4-tetrahydroisoquinolin-7-yl)-4-ethoxy-3-(trifluoromethyl)benzamide.
| Compound Name | N-(1-chloro-1,2,3,4-tetrahydroisoquinolin-7-yl)-4-ethoxy-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 91378525 |
| Molecular Formula | C19H18ClF3N2O2 |
| Molecular Weight | 398.81 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | N-(1-chloro-1,2,3,4-tetrahydroisoquinolin-7-yl)-4-ethoxy-3-(trifluoromethyl)benzamide |
| SMILES | CCOc1ccc(C(=O)Nc2ccc3c(c2)C(Cl)NCC3)cc1C(F)(F)F |
| InChI | InChI=1S/C19H18ClF3N2O2/c1-2-27-16-6-4-12(9-15(16)19(21,22)23)18(26)25-13-5-3-11-7-8-24-17(20)14(11)10-13/h3-6,9-10,17,24H,2,7-8H2,1H3,(H,25,26) |
| InChIKey | KMZGPDIMKQYVHC-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.81 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|