C13H21N2O7+ — CID 91379474
carboxy-bis(carboxymethyl)-[5-(prop-2-enoylamino)pentyl]azanium (PubChem CID 91379474) has the molecular formula C13H21N2O7+ and a molecular weight of 317.32 g/mol. Its IUPAC name is carboxy-bis(carboxymethyl)-[5-(prop-2-enoylamino)pentyl]azanium.
| Compound Name | carboxy-bis(carboxymethyl)-[5-(prop-2-enoylamino)pentyl]azanium |
|---|---|
| PubChem CID | 91379474 |
| Molecular Formula | C13H21N2O7+ |
| Molecular Weight | 317.32 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | carboxy-bis(carboxymethyl)-[5-(prop-2-enoylamino)pentyl]azanium |
| SMILES | C=CC(=O)NCCCCC[N+](CC(=O)O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C13H20N2O7/c1-2-10(16)14-6-4-3-5-7-15(13(21)22,8-11(17)18)9-12(19)20/h2H,1,3-9H2,(H3-,14,16,17,18,19,20,21,22)/p+1 |
| InChIKey | RDFKZNYNKQNFGZ-UHFFFAOYSA-O |
| XLogP | 0.12 |
| TPSA | 141.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.32 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|