C20H20ClN3S — CID 91385785
6-chloro-5-(1-methylindol-5-yl)-2-(2-methylpropylsulfanyl)-1H-benzimidazole (PubChem CID 91385785) has the molecular formula C20H20ClN3S and a molecular weight of 369.92 g/mol. Its IUPAC name is 6-chloro-5-(1-methylindol-5-yl)-2-(2-methylpropylsulfanyl)-1H-benzimidazole.
| Compound Name | 6-chloro-5-(1-methylindol-5-yl)-2-(2-methylpropylsulfanyl)-1H-benzimidazole |
|---|---|
| PubChem CID | 91385785 |
| Molecular Formula | C20H20ClN3S |
| Molecular Weight | 369.92 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | 6-chloro-5-(1-methylindol-5-yl)-2-(2-methylpropylsulfanyl)-1H-benzimidazole |
| SMILES | CC(C)CSc1nc2cc(-c3ccc4c(ccn4C)c3)c(Cl)cc2[nH]1 |
| InChI | InChI=1S/C20H20ClN3S/c1-12(2)11-25-20-22-17-9-15(16(21)10-18(17)23-20)13-4-5-19-14(8-13)6-7-24(19)3/h4-10,12H,11H2,1-3H3,(H,22,23) |
| InChIKey | CNYAMABYLQKUAS-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.92 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |