About 2-[[5-(1,3-benzodioxol-5-yl)-6-chloro-1H-benzimidazol-2-yl]sulfanyl]acetic acid
2-[[5-(1,3-benzodioxol-5-yl)-6-chloro-1H-benzimidazol-2-yl]sulfanyl]acetic acid (PubChem CID 58387209) has the molecular formula C16H11ClN2O4S
and a molecular weight of 362.79 g/mol. Its IUPAC name is 2-[[5-(1,3-benzodioxol-5-yl)-6-chloro-1H-benzimidazol-2-yl]sulfanyl]acetic acid.
Molecular Properties
| Compound Name | 2-[[5-(1,3-benzodioxol-5-yl)-6-chloro-1H-benzimidazol-2-yl]sulfanyl]acetic acid |
| PubChem CID | 58387209 |
| Molecular Formula | C16H11ClN2O4S |
| Molecular Weight | 362.79 g/mol |
| Exact Mass | 362.01 |
| IUPAC Name | 2-[[5-(1,3-benzodioxol-5-yl)-6-chloro-1H-benzimidazol-2-yl]sulfanyl]acetic acid |
| SMILES | O=C(O)CSc1nc2cc(-c3ccc4c(c3)OCO4)c(Cl)cc2[nH]1 |
| InChI | InChI=1S/C16H11ClN2O4S/c17-10-5-12-11(18-16(19-12)24-6-15(20)21)4-9(10)8-1-2-13-14(3-8)23-7-22-13/h1-5H,6-7H2,(H,18,19)(H,20,21) |
| InChIKey | GGPXVCIPALCZCA-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 84.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.79 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[[5-(1,3-benzodioxol-5-yl)-6-chloro-1H-benzimidazol-2-yl]sulfanyl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[5-(1,3-benzodioxol-5-yl)-6-chloro-1H-benzimidazol-2-yl]sulfanyl]acetic acid?
The IUPAC name of 2-[[5-(1,3-benzodioxol-5-yl)-6-chloro-1H-benzimidazol-2-yl]sulfanyl]acetic acid (CID 58387209) is 2-[[5-(1,3-benzodioxol-5-yl)-6-chloro-1H-benzimidazol-2-yl]sulfanyl]acetic acid.
What is the SMILES notation for 2-[[5-(1,3-benzodioxol-5-yl)-6-chloro-1H-benzimidazol-2-yl]sulfanyl]acetic acid?
The canonical SMILES for 2-[[5-(1,3-benzodioxol-5-yl)-6-chloro-1H-benzimidazol-2-yl]sulfanyl]acetic acid is O=C(O)CSc1nc2cc(-c3ccc4c(c3)OCO4)c(Cl)cc2[nH]1.
What is the InChIKey of 2-[[5-(1,3-benzodioxol-5-yl)-6-chloro-1H-benzimidazol-2-yl]sulfanyl]acetic acid?
The InChIKey is GGPXVCIPALCZCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11ClN2O4S/c17-10-5-12-11(18-16(19-12)24-6-15(20)21)4-9(10)8-1-2-13-14(3-8)23-7-22-13/h1-5H,6-7H2,(H,18,19)(H,20,21).
What are the key properties of 2-[[5-(1,3-benzodioxol-5-yl)-6-chloro-1H-benzimidazol-2-yl]sulfanyl]acetic acid?
2-[[5-(1,3-benzodioxol-5-yl)-6-chloro-1H-benzimidazol-2-yl]sulfanyl]acetic acid has a molecular weight of 362.79 g/mol, XLogP of 3.79, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[5-(1,3-benzodioxol-5-yl)-6-chloro-1H-benzimidazol-2-yl]sulfanyl]acetic acid is sourced from PubChem (CID 58387209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).