C17H14ClN3S — CID 90710556
6-chloro-2-ethylsulfanyl-5-(1H-indol-5-yl)-1H-benzimidazole (PubChem CID 90710556) has the molecular formula C17H14ClN3S and a molecular weight of 327.84 g/mol. Its IUPAC name is 6-chloro-2-ethylsulfanyl-5-(1H-indol-5-yl)-1H-benzimidazole.
| Compound Name | 6-chloro-2-ethylsulfanyl-5-(1H-indol-5-yl)-1H-benzimidazole |
|---|---|
| PubChem CID | 90710556 |
| Molecular Formula | C17H14ClN3S |
| Molecular Weight | 327.84 g/mol |
| Exact Mass | 327.06 |
| IUPAC Name | 6-chloro-2-ethylsulfanyl-5-(1H-indol-5-yl)-1H-benzimidazole |
| SMILES | CCSc1nc2cc(-c3ccc4[nH]ccc4c3)c(Cl)cc2[nH]1 |
| InChI | InChI=1S/C17H14ClN3S/c1-2-22-17-20-15-8-12(13(18)9-16(15)21-17)10-3-4-14-11(7-10)5-6-19-14/h3-9,19H,2H2,1H3,(H,20,21) |
| InChIKey | NILOQTKNHIQDPS-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 44.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.84 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |