C15H20N2O2 — CID 91387642
2-[(2S)-2-amino-3,3-dimethylbutyl]-1-hydroxyisoquinolin-3-one (PubChem CID 91387642) has the molecular formula C15H20N2O2 and a molecular weight of 260.34 g/mol. Its IUPAC name is 2-[(2S)-2-amino-3,3-dimethylbutyl]-1-hydroxyisoquinolin-3-one.
| Compound Name | 2-[(2S)-2-amino-3,3-dimethylbutyl]-1-hydroxyisoquinolin-3-one |
|---|---|
| PubChem CID | 91387642 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | 2-[(2S)-2-amino-3,3-dimethylbutyl]-1-hydroxyisoquinolin-3-one |
| SMILES | CC(C)(C)[C@H](N)Cn1c(O)c2ccccc2cc1=O |
| InChI | InChI=1S/C15H20N2O2/c1-15(2,3)12(16)9-17-13(18)8-10-6-4-5-7-11(10)14(17)19/h4-8,12,19H,9,16H2,1-3H3/t12-/m1/s1 |
| InChIKey | ZMDCEOFRPPVRPE-GFCCVEGCSA-N |
| XLogP | 2.08 |
| TPSA | 68.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |