C20H29NO6 — CID 166070983
5-(1,3-dihydroxyisoindol-2-yl)pentyl (1-hydroxy-3,3-dimethylbutan-2-yl) carbonate (PubChem CID 166070983) has the molecular formula C20H29NO6 and a molecular weight of 379.45 g/mol. Its IUPAC name is 5-(1,3-dihydroxyisoindol-2-yl)pentyl (1-hydroxy-3,3-dimethylbutan-2-yl) carbonate.
| Compound Name | 5-(1,3-dihydroxyisoindol-2-yl)pentyl (1-hydroxy-3,3-dimethylbutan-2-yl) carbonate |
|---|---|
| PubChem CID | 166070983 |
| Molecular Formula | C20H29NO6 |
| Molecular Weight | 379.45 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | 5-(1,3-dihydroxyisoindol-2-yl)pentyl (1-hydroxy-3,3-dimethylbutan-2-yl) carbonate |
| SMILES | CC(C)(C)C(CO)OC(=O)OCCCCCn1c(O)c2ccccc2c1O |
| InChI | InChI=1S/C20H29NO6/c1-20(2,3)16(13-22)27-19(25)26-12-8-4-7-11-21-17(23)14-9-5-6-10-15(14)18(21)24/h5-6,9-10,16,22-24H,4,7-8,11-13H2,1-3H3 |
| InChIKey | AEGCFIQDHVQCER-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.45 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|