C16H17N3O6S — CID 91391329
carbamoyl 5-(3,4-dimethoxyphenyl)-2-(methylcarbamoylamino)thiophene-3-carboxylate (PubChem CID 91391329) has the molecular formula C16H17N3O6S and a molecular weight of 379.39 g/mol. Its IUPAC name is carbamoyl 5-(3,4-dimethoxyphenyl)-2-(methylcarbamoylamino)thiophene-3-carboxylate.
| Compound Name | carbamoyl 5-(3,4-dimethoxyphenyl)-2-(methylcarbamoylamino)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 91391329 |
| Molecular Formula | C16H17N3O6S |
| Molecular Weight | 379.39 g/mol |
| Exact Mass | 379.08 |
| IUPAC Name | carbamoyl 5-(3,4-dimethoxyphenyl)-2-(methylcarbamoylamino)thiophene-3-carboxylate |
| SMILES | CNC(=O)Nc1sc(-c2ccc(OC)c(OC)c2)cc1C(=O)OC(N)=O |
| InChI | InChI=1S/C16H17N3O6S/c1-18-16(22)19-13-9(14(20)25-15(17)21)7-12(26-13)8-4-5-10(23-2)11(6-8)24-3/h4-7H,1-3H3,(H2,17,21)(H2,18,19,22) |
| InChIKey | KSFQZCLHXCKFNX-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 128.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.39 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|