C21H21NO2 — CID 91393972
N,N-dibenzyl-6-hydroxycyclohexa-1,3-diene-1-carboxamide (PubChem CID 91393972) has the molecular formula C21H21NO2 and a molecular weight of 319.40 g/mol. Its IUPAC name is N,N-dibenzyl-6-hydroxycyclohexa-1,3-diene-1-carboxamide.
| Compound Name | N,N-dibenzyl-6-hydroxycyclohexa-1,3-diene-1-carboxamide |
|---|---|
| PubChem CID | 91393972 |
| Molecular Formula | C21H21NO2 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | N,N-dibenzyl-6-hydroxycyclohexa-1,3-diene-1-carboxamide |
| SMILES | O=C(C1=CC=CCC1O)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C21H21NO2/c23-20-14-8-7-13-19(20)21(24)22(15-17-9-3-1-4-10-17)16-18-11-5-2-6-12-18/h1-13,20,23H,14-16H2 |
| InChIKey | NOLSGQKRIMPGLR-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |