C36H28F4N2O2 — CID 3094070
1-N,1-N,3-N,3-N-tetrabenzyl-2,4,5,6-tetrafluorobenzene-1,3-dicarboxamide (PubChem CID 3094070) has the molecular formula C36H28F4N2O2 and a molecular weight of 596.62 g/mol. Its IUPAC name is 1-N,1-N,3-N,3-N-tetrabenzyl-2,4,5,6-tetrafluorobenzene-1,3-dicarboxamide.
| Compound Name | 1-N,1-N,3-N,3-N-tetrabenzyl-2,4,5,6-tetrafluorobenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 3094070 |
| Molecular Formula | C36H28F4N2O2 |
| Molecular Weight | 596.62 g/mol |
| Exact Mass | 596.21 |
| IUPAC Name | 1-N,1-N,3-N,3-N-tetrabenzyl-2,4,5,6-tetrafluorobenzene-1,3-dicarboxamide |
| SMILES | O=C(c1c(F)c(F)c(F)c(C(=O)N(Cc2ccccc2)Cc2ccccc2)c1F)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C36H28F4N2O2/c37-31-29(35(43)41(21-25-13-5-1-6-14-25)22-26-15-7-2-8-16-26)32(38)34(40)33(39)30(31)36(44)42(23-27-17-9-3-10-18-27)24-28-19-11-4-12-20-28/h1-20H,21-24H2 |
| InChIKey | ZAVLSQCKAWRYID-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.62 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|