C19H32O5Si — CID 91395934
methyl (1S,2S,8S,8aS)-8-[tert-butyl(dimethyl)silyl]oxy-2-methyl-5,6-dioxo-1,2,3,4,4a,7,8,8a-octahydronaphthalene-1-carboxylate (PubChem CID 91395934) has the molecular formula C19H32O5Si and a molecular weight of 368.55 g/mol. Its IUPAC name is methyl (1S,2S,8S,8aS)-8-[tert-butyl(dimethyl)silyl]oxy-2-methyl-5,6-dioxo-1,2,3,4,4a,7,8,8a-octahydronaphthalene-1-carboxylate.
| Compound Name | methyl (1S,2S,8S,8aS)-8-[tert-butyl(dimethyl)silyl]oxy-2-methyl-5,6-dioxo-1,2,3,4,4a,7,8,8a-octahydronaphthalene-1-carboxylate |
|---|---|
| PubChem CID | 91395934 |
| Molecular Formula | C19H32O5Si |
| Molecular Weight | 368.55 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | methyl (1S,2S,8S,8aS)-8-[tert-butyl(dimethyl)silyl]oxy-2-methyl-5,6-dioxo-1,2,3,4,4a,7,8,8a-octahydronaphthalene-1-carboxylate |
| SMILES | COC(=O)[C@@H]1[C@@H]2C(CC[C@@H]1C)C(=O)C(=O)C[C@@H]2O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H32O5Si/c1-11-8-9-12-16(15(11)18(22)23-5)14(10-13(20)17(12)21)24-25(6,7)19(2,3)4/h11-12,14-16H,8-10H2,1-7H3/t11-,12?,14-,15-,16+/m0/s1 |
| InChIKey | JJCHMAGRZLJEAB-XADPZNNLSA-N |
| XLogP | 3.37 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.55 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|