C42H46N4O3 — CID 91402790
ethyl (2S)-3-[4-[[4-[3-(2-methylphenyl)propylcarbamoyl]-2-phenylquinolin-3-yl]methyl]piperazin-1-yl]-2-phenylpropanoate (PubChem CID 91402790) has the molecular formula C42H46N4O3 and a molecular weight of 654.86 g/mol. Its IUPAC name is ethyl (2S)-3-[4-[[4-[3-(2-methylphenyl)propylcarbamoyl]-2-phenylquinolin-3-yl]methyl]piperazin-1-yl]-2-phenylpropanoate.
| Compound Name | ethyl (2S)-3-[4-[[4-[3-(2-methylphenyl)propylcarbamoyl]-2-phenylquinolin-3-yl]methyl]piperazin-1-yl]-2-phenylpropanoate |
|---|---|
| PubChem CID | 91402790 |
| Molecular Formula | C42H46N4O3 |
| Molecular Weight | 654.86 g/mol |
| Exact Mass | 654.36 |
| IUPAC Name | ethyl (2S)-3-[4-[[4-[3-(2-methylphenyl)propylcarbamoyl]-2-phenylquinolin-3-yl]methyl]piperazin-1-yl]-2-phenylpropanoate |
| SMILES | CCOC(=O)C(CN1CCN(Cc2c(-c3ccccc3)nc3ccccc3c2C(=O)NCCCc2ccccc2C)CC1)c1ccccc1 |
| InChI | InChI=1S/C42H46N4O3/c1-3-49-42(48)36(33-17-6-4-7-18-33)29-45-25-27-46(28-26-45)30-37-39(41(47)43-24-14-21-32-16-11-10-15-31(32)2)35-22-12-13-23-38(35)44-40(37)34-19-8-5-9-20-34/h4-13,15-20,22-23,36H,3,14,21,24-30H2,1-2H3,(H,43,47) |
| InChIKey | KPVVFUKXPSBFHB-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.86 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|