C59H56 — CID 91409529
3-(5,6-dihydronaphthalen-2-yl)-6,12-bis(9,9-dimethyl-4,4a-dihydrofluoren-2-yl)-2-methyl-3,4,5,6,11,12-hexahydrochrysene (PubChem CID 91409529) has the molecular formula C59H56 and a molecular weight of 765.10 g/mol. Its IUPAC name is 3-(5,6-dihydronaphthalen-2-yl)-6,12-bis(9,9-dimethyl-4,4a-dihydrofluoren-2-yl)-2-methyl-3,4,5,6,11,12-hexahydrochrysene.
| Compound Name | 3-(5,6-dihydronaphthalen-2-yl)-6,12-bis(9,9-dimethyl-4,4a-dihydrofluoren-2-yl)-2-methyl-3,4,5,6,11,12-hexahydrochrysene |
|---|---|
| PubChem CID | 91409529 |
| Molecular Formula | C59H56 |
| Molecular Weight | 765.10 g/mol |
| Exact Mass | 764.44 |
| IUPAC Name | 3-(5,6-dihydronaphthalen-2-yl)-6,12-bis(9,9-dimethyl-4,4a-dihydrofluoren-2-yl)-2-methyl-3,4,5,6,11,12-hexahydrochrysene |
| SMILES | CC1=CC2=C(CC1c1ccc3c(c1)C=CCC3)C1=C(CC2C2=CCC3C(=C2)C(C)(C)c2ccccc23)c2ccccc2C(C2=CCC3C(=C2)C(C)(C)c2ccccc23)C1 |
| InChI | InChI=1S/C59H56/c1-35-28-50-49(40-25-27-46-44-19-11-13-21-55(44)59(4,5)57(46)31-40)34-51-42-17-9-8-16-41(42)48(39-24-26-45-43-18-10-12-20-54(43)58(2,3)56(45)30-39)33-53(51)52(50)32-47(35)38-23-22-36-14-6-7-15-37(36)29-38/h7-13,15-25,28-31,45-49H,6,14,26-27,32-34H2,1-5H3 |
| InChIKey | JDIHQKWAZGAOTH-UHFFFAOYSA-N |
| XLogP | 15.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.10 |
| LogP ≤ 5 | 15.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |