C14H14N2 — CID 91416173
10-methyl-1,9a-dihydroacridin-9-imine (PubChem CID 91416173) has the molecular formula C14H14N2 and a molecular weight of 210.28 g/mol. Its IUPAC name is 10-methyl-1,9a-dihydroacridin-9-imine.
| Compound Name | 10-methyl-1,9a-dihydroacridin-9-imine |
|---|---|
| PubChem CID | 91416173 |
| Molecular Formula | C14H14N2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | 10-methyl-1,9a-dihydroacridin-9-imine |
| SMILES | [H]/N=C1/c2ccccc2N(C)C2=CC=CCC21 |
| InChI | InChI=1S/C14H14N2/c1-16-12-8-4-2-6-10(12)14(15)11-7-3-5-9-13(11)16/h2-6,8-9,11,15H,7H2,1H3/b15-14- |
| InChIKey | WQINSDVKJLMBLZ-PFONDFGASA-N |
| XLogP | 2.96 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|