C36H39N5O10S3 — CID 91416466
N-[6-[ethoxy-(2-sulfanylphenyl)sulfonylamino]-5-(2-methoxyphenoxy)-2-(3,4,5-trimethoxyphenyl)pyrimidin-4-yl]-5-propan-2-ylpyridine-2-sulfonamide (PubChem CID 91416466) has the molecular formula C36H39N5O10S3 and a molecular weight of 797.93 g/mol. Its IUPAC name is N-[6-[ethoxy-(2-sulfanylphenyl)sulfonylamino]-5-(2-methoxyphenoxy)-2-(3,4,5-trimethoxyphenyl)pyrimidin-4-yl]-5-propan-2-ylpyridine-2-sulfonamide.
| Compound Name | N-[6-[ethoxy-(2-sulfanylphenyl)sulfonylamino]-5-(2-methoxyphenoxy)-2-(3,4,5-trimethoxyphenyl)pyrimidin-4-yl]-5-propan-2-ylpyridine-2-sulfonamide |
|---|---|
| PubChem CID | 91416466 |
| Molecular Formula | C36H39N5O10S3 |
| Molecular Weight | 797.93 g/mol |
| Exact Mass | 797.19 |
| IUPAC Name | N-[6-[ethoxy-(2-sulfanylphenyl)sulfonylamino]-5-(2-methoxyphenoxy)-2-(3,4,5-trimethoxyphenyl)pyrimidin-4-yl]-5-propan-2-ylpyridine-2-sulfonamide |
| SMILES | CCON(c1nc(-c2cc(OC)c(OC)c(OC)c2)nc(NS(=O)(=O)c2ccc(C(C)C)cn2)c1Oc1ccccc1OC)S(=O)(=O)c1ccccc1S |
| InChI | InChI=1S/C36H39N5O10S3/c1-8-50-41(54(44,45)30-16-12-11-15-29(30)52)36-33(51-26-14-10-9-13-25(26)46-4)35(40-53(42,43)31-18-17-23(21-37-31)22(2)3)38-34(39-36)24-19-27(47-5)32(49-7)28(20-24)48-6/h9-22,52H,8H2,1-7H3,(H,38,39,40) |
| InChIKey | JTQDHVQKEBGHKM-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 177.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 797.93 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|