C20H23BCl2S2 — CID 91417600
[(E)-1,8-dichloro-8-phenyloct-4-enyl]benzene;sulfanylideneborinothioic acid (PubChem CID 91417600) has the molecular formula C20H23BCl2S2 and a molecular weight of 409.26 g/mol. Its IUPAC name is [(E)-1,8-dichloro-8-phenyloct-4-enyl]benzene;sulfanylideneborinothioic acid.
| Compound Name | [(E)-1,8-dichloro-8-phenyloct-4-enyl]benzene;sulfanylideneborinothioic acid |
|---|---|
| PubChem CID | 91417600 |
| Molecular Formula | C20H23BCl2S2 |
| Molecular Weight | 409.26 g/mol |
| Exact Mass | 408.07 |
| IUPAC Name | [(E)-1,8-dichloro-8-phenyloct-4-enyl]benzene;sulfanylideneborinothioic acid |
| SMILES | ClC(CC/C=C/CCC(Cl)c1ccccc1)c1ccccc1.S=BS |
| InChI | InChI=1S/C20H22Cl2.BHS2/c21-19(17-11-5-3-6-12-17)15-9-1-2-10-16-20(22)18-13-7-4-8-14-18;2-1-3/h1-8,11-14,19-20H,9-10,15-16H2;2H/b2-1+; |
| InChIKey | SENHPCKUOPNNHS-TYYBGVCCSA-N |
| XLogP | 7.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.26 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|