C24H24F2N2O2 — CID 91420610
(2,6-difluoro-3-hexylphenyl)-[5-(3-methoxyprop-1-ynyl)-1H-pyrrolo[2,3-b]pyridin-3-yl]methanone (PubChem CID 91420610) has the molecular formula C24H24F2N2O2 and a molecular weight of 410.46 g/mol. Its IUPAC name is (2,6-difluoro-3-hexylphenyl)-[5-(3-methoxyprop-1-ynyl)-1H-pyrrolo[2,3-b]pyridin-3-yl]methanone.
| Compound Name | (2,6-difluoro-3-hexylphenyl)-[5-(3-methoxyprop-1-ynyl)-1H-pyrrolo[2,3-b]pyridin-3-yl]methanone |
|---|---|
| PubChem CID | 91420610 |
| Molecular Formula | C24H24F2N2O2 |
| Molecular Weight | 410.46 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | (2,6-difluoro-3-hexylphenyl)-[5-(3-methoxyprop-1-ynyl)-1H-pyrrolo[2,3-b]pyridin-3-yl]methanone |
| SMILES | CCCCCCc1ccc(F)c(C(=O)c2c[nH]c3ncc(C#CCOC)cc23)c1F |
| InChI | InChI=1S/C24H24F2N2O2/c1-3-4-5-6-9-17-10-11-20(25)21(22(17)26)23(29)19-15-28-24-18(19)13-16(14-27-24)8-7-12-30-2/h10-11,13-15H,3-6,9,12H2,1-2H3,(H,27,28) |
| InChIKey | HIUMXXUBODSPCH-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.46 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|