C12H12N2O3 — CID 91421363
(2,5-dihydroxypyrrol-1-yl) N-methylbenzenecarboximidate (PubChem CID 91421363) has the molecular formula C12H12N2O3 and a molecular weight of 232.24 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) N-methylbenzenecarboximidate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) N-methylbenzenecarboximidate |
|---|---|
| PubChem CID | 91421363 |
| Molecular Formula | C12H12N2O3 |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) N-methylbenzenecarboximidate |
| SMILES | C/N=C(/On1c(O)ccc1O)c1ccccc1 |
| InChI | InChI=1S/C12H12N2O3/c1-13-12(9-5-3-2-4-6-9)17-14-10(15)7-8-11(14)16/h2-8,15-16H,1H3/b13-12+ |
| InChIKey | HTFMBDOCSKEZKE-OUKQBFOZSA-N |
| XLogP | 1.40 |
| TPSA | 66.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|