About 5-hydroxypentanoate;propanoic acid
5-hydroxypentanoate;propanoic acid (PubChem CID 91421786) has the molecular formula C8H15O5-
and a molecular weight of 191.20 g/mol. Its IUPAC name is 5-hydroxypentanoate;propanoic acid.
Molecular Properties
| Compound Name | 5-hydroxypentanoate;propanoic acid |
| PubChem CID | 91421786 |
| Molecular Formula | C8H15O5- |
| Molecular Weight | 191.20 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | 5-hydroxypentanoate;propanoic acid |
| SMILES | CCC(=O)O.O=C([O-])CCCCO |
| InChI | InChI=1S/C5H10O3.C3H6O2/c6-4-2-1-3-5(7)8;1-2-3(4)5/h6H,1-4H2,(H,7,8);2H2,1H3,(H,4,5)/p-1 |
| InChIKey | SMKCEMCRPLWXGM-UHFFFAOYSA-M |
| XLogP | -0.62 |
| TPSA | 97.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.20 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-hydroxypentanoate;propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hydroxypentanoate;propanoic acid?
The IUPAC name of 5-hydroxypentanoate;propanoic acid (CID 91421786) is 5-hydroxypentanoate;propanoic acid.
What is the SMILES notation for 5-hydroxypentanoate;propanoic acid?
The canonical SMILES for 5-hydroxypentanoate;propanoic acid is CCC(=O)O.O=C([O-])CCCCO.
What is the InChIKey of 5-hydroxypentanoate;propanoic acid?
The InChIKey is SMKCEMCRPLWXGM-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H10O3.C3H6O2/c6-4-2-1-3-5(7)8;1-2-3(4)5/h6H,1-4H2,(H,7,8);2H2,1H3,(H,4,5)/p-1.
What are the key properties of 5-hydroxypentanoate;propanoic acid?
5-hydroxypentanoate;propanoic acid has a molecular weight of 191.20 g/mol, XLogP of -0.62, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxypentanoate;propanoic acid is sourced from PubChem (CID 91421786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).