C20H20N4O2 — CID 91422407
4,7-diimino-1-(3-methoxyphenyl)imino-5-phenyliminoheptan-3-one (PubChem CID 91422407) has the molecular formula C20H20N4O2 and a molecular weight of 348.41 g/mol. Its IUPAC name is 4,7-diimino-1-(3-methoxyphenyl)imino-5-phenyliminoheptan-3-one.
| Compound Name | 4,7-diimino-1-(3-methoxyphenyl)imino-5-phenyliminoheptan-3-one |
|---|---|
| PubChem CID | 91422407 |
| Molecular Formula | C20H20N4O2 |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | 4,7-diimino-1-(3-methoxyphenyl)imino-5-phenyliminoheptan-3-one |
| SMILES | [H]/N=C\CC(=N\c1ccccc1)/C(=N\[H])C(=O)C/C=N/c1cccc(OC)c1 |
| InChI | InChI=1S/C20H20N4O2/c1-26-17-9-5-8-16(14-17)23-13-11-19(25)20(22)18(10-12-21)24-15-6-3-2-4-7-15/h2-9,12-14,21-22H,10-11H2,1H3/b21-12-,22-20+,23-13+,24-18+ |
| InChIKey | DUOYMQBJWOCOBS-DUSIOZLKSA-N |
| XLogP | 4.19 |
| TPSA | 98.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|