C24H22N4O3S2 — CID 91427525
3-benzyl-4-[2-(benzylcarbamoyl)-5-methyl-N-sulfinoanilino]-1,2,5-thiadiazole (PubChem CID 91427525) has the molecular formula C24H22N4O3S2 and a molecular weight of 478.60 g/mol. Its IUPAC name is 3-benzyl-4-[2-(benzylcarbamoyl)-5-methyl-N-sulfinoanilino]-1,2,5-thiadiazole.
| Compound Name | 3-benzyl-4-[2-(benzylcarbamoyl)-5-methyl-N-sulfinoanilino]-1,2,5-thiadiazole |
|---|---|
| PubChem CID | 91427525 |
| Molecular Formula | C24H22N4O3S2 |
| Molecular Weight | 478.60 g/mol |
| Exact Mass | 478.11 |
| IUPAC Name | 3-benzyl-4-[2-(benzylcarbamoyl)-5-methyl-N-sulfinoanilino]-1,2,5-thiadiazole |
| SMILES | Cc1ccc(C(=O)NCc2ccccc2)c(N(c2nsnc2Cc2ccccc2)S(=O)O)c1 |
| InChI | InChI=1S/C24H22N4O3S2/c1-17-12-13-20(24(29)25-16-19-10-6-3-7-11-19)22(14-17)28(33(30)31)23-21(26-32-27-23)15-18-8-4-2-5-9-18/h2-14H,15-16H2,1H3,(H,25,29)(H,30,31) |
| InChIKey | GAYLYEMCNLUPJJ-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 95.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.60 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|