C37H29FN4O6S2 — CID 91427804
[9-benzhydryloxy-7-[(4-fluorophenyl)methyl]-8-hydroxypyrrolo[3,4-g]quinolin-5-yl] 2-acetamido-4-methyl-1,3-thiazole-5-sulfonate (PubChem CID 91427804) has the molecular formula C37H29FN4O6S2 and a molecular weight of 708.79 g/mol. Its IUPAC name is [9-benzhydryloxy-7-[(4-fluorophenyl)methyl]-8-hydroxypyrrolo[3,4-g]quinolin-5-yl] 2-acetamido-4-methyl-1,3-thiazole-5-sulfonate.
| Compound Name | [9-benzhydryloxy-7-[(4-fluorophenyl)methyl]-8-hydroxypyrrolo[3,4-g]quinolin-5-yl] 2-acetamido-4-methyl-1,3-thiazole-5-sulfonate |
|---|---|
| PubChem CID | 91427804 |
| Molecular Formula | C37H29FN4O6S2 |
| Molecular Weight | 708.79 g/mol |
| Exact Mass | 708.15 |
| IUPAC Name | [9-benzhydryloxy-7-[(4-fluorophenyl)methyl]-8-hydroxypyrrolo[3,4-g]quinolin-5-yl] 2-acetamido-4-methyl-1,3-thiazole-5-sulfonate |
| SMILES | CC(=O)Nc1nc(C)c(S(=O)(=O)Oc2c3cccnc3c(OC(c3ccccc3)c3ccccc3)c3c(O)n(Cc4ccc(F)cc4)cc23)s1 |
| InChI | InChI=1S/C37H29FN4O6S2/c1-22-36(49-37(40-22)41-23(2)43)50(45,46)48-33-28-14-9-19-39-31(28)34(47-32(25-10-5-3-6-11-25)26-12-7-4-8-13-26)30-29(33)21-42(35(30)44)20-24-15-17-27(38)18-16-24/h3-19,21,32,44H,20H2,1-2H3,(H,40,41,43) |
| InChIKey | NJEWZSCPHWMPNZ-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 132.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.79 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|