C15H12IN3O2 — CID 91429855
7-cyano-8-iodo-6-phenyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine-2-carboxylic acid (PubChem CID 91429855) has the molecular formula C15H12IN3O2 and a molecular weight of 393.18 g/mol. Its IUPAC name is 7-cyano-8-iodo-6-phenyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine-2-carboxylic acid.
| Compound Name | 7-cyano-8-iodo-6-phenyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine-2-carboxylic acid |
|---|---|
| PubChem CID | 91429855 |
| Molecular Formula | C15H12IN3O2 |
| Molecular Weight | 393.18 g/mol |
| Exact Mass | 393.00 |
| IUPAC Name | 7-cyano-8-iodo-6-phenyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine-2-carboxylic acid |
| SMILES | N#Cc1c(I)c2n(c1-c1ccccc1)CCN(C(=O)O)C2 |
| InChI | InChI=1S/C15H12IN3O2/c16-13-11(8-17)14(10-4-2-1-3-5-10)19-7-6-18(15(20)21)9-12(13)19/h1-5H,6-7,9H2,(H,20,21) |
| InChIKey | KUFDRYVHYZZYHA-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.18 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|