C34H43FN3O7- — CID 91430203
4-(dimethylamino)-8-[[ethyl-[(1-ethylcyclobutyl)methyl]amino]methyl]-7-fluoro-1,11,12a-trihydroxy-3,12-dioxo-10-prop-2-enoxy-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 91430203) has the molecular formula C34H43FN3O7- and a molecular weight of 624.73 g/mol. Its IUPAC name is 4-(dimethylamino)-8-[[ethyl-[(1-ethylcyclobutyl)methyl]amino]methyl]-7-fluoro-1,11,12a-trihydroxy-3,12-dioxo-10-prop-2-enoxy-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | 4-(dimethylamino)-8-[[ethyl-[(1-ethylcyclobutyl)methyl]amino]methyl]-7-fluoro-1,11,12a-trihydroxy-3,12-dioxo-10-prop-2-enoxy-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 91430203 |
| Molecular Formula | C34H43FN3O7- |
| Molecular Weight | 624.73 g/mol |
| Exact Mass | 624.31 |
| IUPAC Name | 4-(dimethylamino)-8-[[ethyl-[(1-ethylcyclobutyl)methyl]amino]methyl]-7-fluoro-1,11,12a-trihydroxy-3,12-dioxo-10-prop-2-enoxy-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | C=[C-]COc1cc(CN(CC)CC2(CC)CCC2)c(F)c2c1C(O)=C1C(=O)C3(O)C(O)=C(C(N)=O)C(=O)C(N(C)C)C3CC1C2 |
| InChI | InChI=1S/C34H43FN3O7/c1-6-12-45-22-15-19(16-38(8-3)17-33(7-2)10-9-11-33)26(35)20-13-18-14-21-27(37(4)5)29(40)25(32(36)43)31(42)34(21,44)30(41)23(18)28(39)24(20)22/h15,18,21,27,39,42,44H,1,7-14,16-17H2,2-5H3,(H2,36,43)/q-1 |
| InChIKey | SXSVRUTUXVYSOG-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 153.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.73 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|