C16H24N2O3 — CID 91431207
4-[2-(dipropylamino)-1,1-dihydroxyethyl]-1,3-dihydroindol-2-one (PubChem CID 91431207) has the molecular formula C16H24N2O3 and a molecular weight of 292.38 g/mol. Its IUPAC name is 4-[2-(dipropylamino)-1,1-dihydroxyethyl]-1,3-dihydroindol-2-one.
| Compound Name | 4-[2-(dipropylamino)-1,1-dihydroxyethyl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 91431207 |
| Molecular Formula | C16H24N2O3 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | 4-[2-(dipropylamino)-1,1-dihydroxyethyl]-1,3-dihydroindol-2-one |
| SMILES | CCCN(CCC)CC(O)(O)c1cccc2c1CC(=O)N2 |
| InChI | InChI=1S/C16H24N2O3/c1-3-8-18(9-4-2)11-16(20,21)13-6-5-7-14-12(13)10-15(19)17-14/h5-7,20-21H,3-4,8-11H2,1-2H3,(H,17,19) |
| InChIKey | ZZAHGRYGUAYRSR-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|