C16H24N2O7 — CID 91097076
4-[2-[bis(1,1-dihydroxypropyl)amino]-1,1-dihydroxyethyl]-1,3-dihydroindol-2-one (PubChem CID 91097076) has the molecular formula C16H24N2O7 and a molecular weight of 356.38 g/mol. Its IUPAC name is 4-[2-[bis(1,1-dihydroxypropyl)amino]-1,1-dihydroxyethyl]-1,3-dihydroindol-2-one.
| Compound Name | 4-[2-[bis(1,1-dihydroxypropyl)amino]-1,1-dihydroxyethyl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 91097076 |
| Molecular Formula | C16H24N2O7 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | 4-[2-[bis(1,1-dihydroxypropyl)amino]-1,1-dihydroxyethyl]-1,3-dihydroindol-2-one |
| SMILES | CCC(O)(O)N(CC(O)(O)c1cccc2c1CC(=O)N2)C(O)(O)CC |
| InChI | InChI=1S/C16H24N2O7/c1-3-15(22,23)18(16(24,25)4-2)9-14(20,21)11-6-5-7-12-10(11)8-13(19)17-12/h5-7,20-25H,3-4,8-9H2,1-2H3,(H,17,19) |
| InChIKey | BGOSBFXODUUECA-UHFFFAOYSA-N |
| XLogP | -1.28 |
| TPSA | 153.72 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|