C29H48N6O4 — CID 91431605
cyclohexylmethyl N-[[[2-[(4-cyano-1-methylpiperidin-4-yl)carbamoyl]cyclohexyl]-ethylamino]-morpholin-4-ylmethylidene]carbamate (PubChem CID 91431605) has the molecular formula C29H48N6O4 and a molecular weight of 544.74 g/mol. Its IUPAC name is cyclohexylmethyl N-[[[2-[(4-cyano-1-methylpiperidin-4-yl)carbamoyl]cyclohexyl]-ethylamino]-morpholin-4-ylmethylidene]carbamate.
| Compound Name | cyclohexylmethyl N-[[[2-[(4-cyano-1-methylpiperidin-4-yl)carbamoyl]cyclohexyl]-ethylamino]-morpholin-4-ylmethylidene]carbamate |
|---|---|
| PubChem CID | 91431605 |
| Molecular Formula | C29H48N6O4 |
| Molecular Weight | 544.74 g/mol |
| Exact Mass | 544.37 |
| IUPAC Name | cyclohexylmethyl N-[[[2-[(4-cyano-1-methylpiperidin-4-yl)carbamoyl]cyclohexyl]-ethylamino]-morpholin-4-ylmethylidene]carbamate |
| SMILES | CCN(C(=NC(=O)OCC1CCCCC1)N1CCOCC1)C1CCCCC1C(=O)NC1(C#N)CCN(C)CC1 |
| InChI | InChI=1S/C29H48N6O4/c1-3-35(25-12-8-7-11-24(25)26(36)32-29(22-30)13-15-33(2)16-14-29)27(34-17-19-38-20-18-34)31-28(37)39-21-23-9-5-4-6-10-23/h23-25H,3-21H2,1-2H3,(H,32,36) |
| InChIKey | JVAZSEITENLQIO-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 110.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.74 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|